C31H46O3 — CID 90780259
1-cyclohexyl-4-[2-[1-[4-(2,2,5-trimethylhexan-3-yl)phenoxy]ethoxy]ethoxy]benzene (PubChem CID 90780259) has the molecular formula C31H46O3 and a molecular weight of 466.71 g/mol. Its IUPAC name is 1-cyclohexyl-4-[2-[1-[4-(2,2,5-trimethylhexan-3-yl)phenoxy]ethoxy]ethoxy]benzene.
| Compound Name | 1-cyclohexyl-4-[2-[1-[4-(2,2,5-trimethylhexan-3-yl)phenoxy]ethoxy]ethoxy]benzene |
|---|---|
| PubChem CID | 90780259 |
| Molecular Formula | C31H46O3 |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.34 |
| IUPAC Name | 1-cyclohexyl-4-[2-[1-[4-(2,2,5-trimethylhexan-3-yl)phenoxy]ethoxy]ethoxy]benzene |
| SMILES | CC(C)CC(c1ccc(OC(C)OCCOc2ccc(C3CCCCC3)cc2)cc1)C(C)(C)C |
| InChI | InChI=1S/C31H46O3/c1-23(2)22-30(31(4,5)6)27-14-18-29(19-15-27)34-24(3)32-20-21-33-28-16-12-26(13-17-28)25-10-8-7-9-11-25/h12-19,23-25,30H,7-11,20-22H2,1-6H3 |
| InChIKey | UYDZMAHRYWNUSV-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|