C28H40O2 — CID 89343379
1-butan-2-yl-4-[1-[2-(4-cyclohexylphenyl)ethoxy]-2-methylpropoxy]benzene (PubChem CID 89343379) has the molecular formula C28H40O2 and a molecular weight of 408.63 g/mol. Its IUPAC name is 1-butan-2-yl-4-[1-[2-(4-cyclohexylphenyl)ethoxy]-2-methylpropoxy]benzene.
| Compound Name | 1-butan-2-yl-4-[1-[2-(4-cyclohexylphenyl)ethoxy]-2-methylpropoxy]benzene |
|---|---|
| PubChem CID | 89343379 |
| Molecular Formula | C28H40O2 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | 1-butan-2-yl-4-[1-[2-(4-cyclohexylphenyl)ethoxy]-2-methylpropoxy]benzene |
| SMILES | CCC(C)c1ccc(OC(OCCc2ccc(C3CCCCC3)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C28H40O2/c1-5-22(4)24-15-17-27(18-16-24)30-28(21(2)3)29-20-19-23-11-13-26(14-12-23)25-9-7-6-8-10-25/h11-18,21-22,25,28H,5-10,19-20H2,1-4H3 |
| InChIKey | AQUGIJTZRAIWGR-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|