C27H44O2 — CID 123633682
1-[3,3-dimethyl-1-(2-methylidenebut-3-enoxy)butoxy]-4-(2,2,5,5-tetramethylhexan-3-yl)benzene (PubChem CID 123633682) has the molecular formula C27H44O2 and a molecular weight of 400.65 g/mol. Its IUPAC name is 1-[3,3-dimethyl-1-(2-methylidenebut-3-enoxy)butoxy]-4-(2,2,5,5-tetramethylhexan-3-yl)benzene.
| Compound Name | 1-[3,3-dimethyl-1-(2-methylidenebut-3-enoxy)butoxy]-4-(2,2,5,5-tetramethylhexan-3-yl)benzene |
|---|---|
| PubChem CID | 123633682 |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | 1-[3,3-dimethyl-1-(2-methylidenebut-3-enoxy)butoxy]-4-(2,2,5,5-tetramethylhexan-3-yl)benzene |
| SMILES | C=CC(=C)COC(CC(C)(C)C)Oc1ccc(C(CC(C)(C)C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H44O2/c1-12-20(2)19-28-24(18-26(6,7)8)29-22-15-13-21(14-16-22)23(27(9,10)11)17-25(3,4)5/h12-16,23-24H,1-2,17-19H2,3-11H3 |
| InChIKey | PLLZAJVFFDUFDH-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|