C21H29F5O3 — CID 89078877
2,2,3,3,3-pentafluoropropyl 2-[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]acetate (PubChem CID 89078877) has the molecular formula C21H29F5O3 and a molecular weight of 424.45 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl 2-[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]acetate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl 2-[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 89078877 |
| Molecular Formula | C21H29F5O3 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 2-[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]acetate |
| SMILES | CC(C)(C)CC(c1ccc(OCC(=O)OCC(F)(F)C(F)(F)F)cc1)C(C)(C)C |
| InChI | InChI=1S/C21H29F5O3/c1-18(2,3)11-16(19(4,5)6)14-7-9-15(10-8-14)28-12-17(27)29-13-20(22,23)21(24,25)26/h7-10,16H,11-13H2,1-6H3 |
| InChIKey | OGPWVPXRJBTSIL-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|