[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid

C16H27O3P — CID 71033304

IUPAC[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid
SMILESCC(C)(C)CC(c1ccc(P(=O)(O)O)cc1)C(C)(C)C
InChIInChI=1S/C16H27O3P/c1-15(2,3)11-14(16(4,5)6)12-7-9-13(10-8-12)20(17,18)19/h7-10,14H,11H2,1-6H3,(H2,17,18,19)
InChIKeyHXLCBKOPLGCGDT-UHFFFAOYSA-N
MW298.36 g/mol
LogP4.06
Rot. Bonds3

About [4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid

[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid (PubChem CID 71033304) has the molecular formula C16H27O3P and a molecular weight of 298.36 g/mol. Its IUPAC name is [4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid.

Molecular Properties

Compound Name[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid
PubChem CID71033304
Molecular FormulaC16H27O3P
Molecular Weight298.36 g/mol
Exact Mass298.17
IUPAC Name[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid
SMILESCC(C)(C)CC(c1ccc(P(=O)(O)O)cc1)C(C)(C)C
InChIInChI=1S/C16H27O3P/c1-15(2,3)11-14(16(4,5)6)12-7-9-13(10-8-12)20(17,18)19/h7-10,14H,11H2,1-6H3,(H2,17,18,19)
InChIKeyHXLCBKOPLGCGDT-UHFFFAOYSA-N
XLogP4.06
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.36
LogP ≤ 54.06
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze [4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid?
The IUPAC name of [4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid (CID 71033304) is [4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid.
What is the SMILES notation for [4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid?
The canonical SMILES for [4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid is CC(C)(C)CC(c1ccc(P(=O)(O)O)cc1)C(C)(C)C.
What is the InChIKey of [4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid?
The InChIKey is HXLCBKOPLGCGDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27O3P/c1-15(2,3)11-14(16(4,5)6)12-7-9-13(10-8-12)20(17,18)19/h7-10,14H,11H2,1-6H3,(H2,17,18,19).
What are the key properties of [4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid?
[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid has a molecular weight of 298.36 g/mol, XLogP of 4.06, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid is sourced from PubChem (CID 71033304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).