C16H27O3P — CID 71033304
[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid (PubChem CID 71033304) has the molecular formula C16H27O3P and a molecular weight of 298.36 g/mol. Its IUPAC name is [4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid.
| Compound Name | [4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid |
|---|---|
| PubChem CID | 71033304 |
| Molecular Formula | C16H27O3P |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | [4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid |
| SMILES | CC(C)(C)CC(c1ccc(P(=O)(O)O)cc1)C(C)(C)C |
| InChI | InChI=1S/C16H27O3P/c1-15(2,3)11-14(16(4,5)6)12-7-9-13(10-8-12)20(17,18)19/h7-10,14H,11H2,1-6H3,(H2,17,18,19) |
| InChIKey | HXLCBKOPLGCGDT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|