C32H53O3P — CID 143754679
2,2,5,5-tetramethylhexan-3-ylbenzene;[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid (PubChem CID 143754679) has the molecular formula C32H53O3P and a molecular weight of 516.75 g/mol. Its IUPAC name is 2,2,5,5-tetramethylhexan-3-ylbenzene;[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid.
| Compound Name | 2,2,5,5-tetramethylhexan-3-ylbenzene;[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid |
|---|---|
| PubChem CID | 143754679 |
| Molecular Formula | C32H53O3P |
| Molecular Weight | 516.75 g/mol |
| Exact Mass | 516.37 |
| IUPAC Name | 2,2,5,5-tetramethylhexan-3-ylbenzene;[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]phosphonic acid |
| SMILES | CC(C)(C)CC(c1ccc(P(=O)(O)O)cc1)C(C)(C)C.CC(C)(C)CC(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C16H27O3P.C16H26/c1-15(2,3)11-14(16(4,5)6)12-7-9-13(10-8-12)20(17,18)19;1-15(2,3)12-14(16(4,5)6)13-10-8-7-9-11-13/h7-10,14H,11H2,1-6H3,(H2,17,18,19);7-11,14H,12H2,1-6H3 |
| InChIKey | KIKCIKMYJSCTIW-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.75 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|