C21H36 — CID 90806094
2,2,5,5,6,7,7-heptamethyloctan-4-ylbenzene (PubChem CID 90806094) has the molecular formula C21H36 and a molecular weight of 288.52 g/mol. Its IUPAC name is 2,2,5,5,6,7,7-heptamethyloctan-4-ylbenzene.
| Compound Name | 2,2,5,5,6,7,7-heptamethyloctan-4-ylbenzene |
|---|---|
| PubChem CID | 90806094 |
| Molecular Formula | C21H36 |
| Molecular Weight | 288.52 g/mol |
| Exact Mass | 288.28 |
| IUPAC Name | 2,2,5,5,6,7,7-heptamethyloctan-4-ylbenzene |
| SMILES | CC(C(C)(C)C)C(C)(C)C(CC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H36/c1-16(20(5,6)7)21(8,9)18(15-19(2,3)4)17-13-11-10-12-14-17/h10-14,16,18H,15H2,1-9H3 |
| InChIKey | ZTIDTFQKYMOMLQ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.52 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |