C27H44O3 — CID 144685019
oxiran-2-ylmethyl 2-tert-butyl-2,3,4,4,7,7-hexamethyl-5-phenyloctanoate (PubChem CID 144685019) has the molecular formula C27H44O3 and a molecular weight of 416.65 g/mol. Its IUPAC name is oxiran-2-ylmethyl 2-tert-butyl-2,3,4,4,7,7-hexamethyl-5-phenyloctanoate.
| Compound Name | oxiran-2-ylmethyl 2-tert-butyl-2,3,4,4,7,7-hexamethyl-5-phenyloctanoate |
|---|---|
| PubChem CID | 144685019 |
| Molecular Formula | C27H44O3 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | oxiran-2-ylmethyl 2-tert-butyl-2,3,4,4,7,7-hexamethyl-5-phenyloctanoate |
| SMILES | CC(C(C)(C)C(CC(C)(C)C)c1ccccc1)C(C)(C(=O)OCC1CO1)C(C)(C)C |
| InChI | InChI=1S/C27H44O3/c1-19(27(10,25(5,6)7)23(28)30-18-21-17-29-21)26(8,9)22(16-24(2,3)4)20-14-12-11-13-15-20/h11-15,19,21-22H,16-18H2,1-10H3 |
| InChIKey | SQKYYIPIDPIETQ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|