C16H30O3 — CID 58610629
oxiran-2-ylmethyl 2-(2,2-dimethylpropyl)-2,4,4-trimethylpentanoate (PubChem CID 58610629) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is oxiran-2-ylmethyl 2-(2,2-dimethylpropyl)-2,4,4-trimethylpentanoate.
| Compound Name | oxiran-2-ylmethyl 2-(2,2-dimethylpropyl)-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 58610629 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | oxiran-2-ylmethyl 2-(2,2-dimethylpropyl)-2,4,4-trimethylpentanoate |
| SMILES | CC(C)(C)CC(C)(CC(C)(C)C)C(=O)OCC1CO1 |
| InChI | InChI=1S/C16H30O3/c1-14(2,3)10-16(7,11-15(4,5)6)13(17)19-9-12-8-18-12/h12H,8-11H2,1-7H3 |
| InChIKey | SFTONKNFZHJFPK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|