C15H24O7 — CID 20769928
bis(oxiran-2-ylmethyl) 2-(methoxymethyl)-2,4-dimethylpentanedioate (PubChem CID 20769928) has the molecular formula C15H24O7 and a molecular weight of 316.35 g/mol. Its IUPAC name is bis(oxiran-2-ylmethyl) 2-(methoxymethyl)-2,4-dimethylpentanedioate.
| Compound Name | bis(oxiran-2-ylmethyl) 2-(methoxymethyl)-2,4-dimethylpentanedioate |
|---|---|
| PubChem CID | 20769928 |
| Molecular Formula | C15H24O7 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | bis(oxiran-2-ylmethyl) 2-(methoxymethyl)-2,4-dimethylpentanedioate |
| SMILES | COCC(C)(CC(C)C(=O)OCC1CO1)C(=O)OCC1CO1 |
| InChI | InChI=1S/C15H24O7/c1-10(13(16)21-7-11-5-19-11)4-15(2,9-18-3)14(17)22-8-12-6-20-12/h10-12H,4-9H2,1-3H3 |
| InChIKey | GZAUBYXUZQZQEV-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 86.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|