About 2-methylpropanoic acid;oxiran-2-ylmethyl 2-methylpropanoate
2-methylpropanoic acid;oxiran-2-ylmethyl 2-methylpropanoate (PubChem CID 161434181) has the molecular formula C11H20O5
and a molecular weight of 232.28 g/mol. Its IUPAC name is 2-methylpropanoic acid;oxiran-2-ylmethyl 2-methylpropanoate.
Molecular Properties
| Compound Name | 2-methylpropanoic acid;oxiran-2-ylmethyl 2-methylpropanoate |
| PubChem CID | 161434181 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 2-methylpropanoic acid;oxiran-2-ylmethyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)O.CC(C)C(=O)OCC1CO1 |
| InChI | InChI=1S/C7H12O3.C4H8O2/c1-5(2)7(8)10-4-6-3-9-6;1-3(2)4(5)6/h5-6H,3-4H2,1-2H3;3H,1-2H3,(H,5,6) |
| InChIKey | VYKOIGFQWQMZSH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropanoic acid;oxiran-2-ylmethyl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanoic acid;oxiran-2-ylmethyl 2-methylpropanoate?
The IUPAC name of 2-methylpropanoic acid;oxiran-2-ylmethyl 2-methylpropanoate (CID 161434181) is 2-methylpropanoic acid;oxiran-2-ylmethyl 2-methylpropanoate.
What is the SMILES notation for 2-methylpropanoic acid;oxiran-2-ylmethyl 2-methylpropanoate?
The canonical SMILES for 2-methylpropanoic acid;oxiran-2-ylmethyl 2-methylpropanoate is CC(C)C(=O)O.CC(C)C(=O)OCC1CO1.
What is the InChIKey of 2-methylpropanoic acid;oxiran-2-ylmethyl 2-methylpropanoate?
The InChIKey is VYKOIGFQWQMZSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3.C4H8O2/c1-5(2)7(8)10-4-6-3-9-6;1-3(2)4(5)6/h5-6H,3-4H2,1-2H3;3H,1-2H3,(H,5,6).
What are the key properties of 2-methylpropanoic acid;oxiran-2-ylmethyl 2-methylpropanoate?
2-methylpropanoic acid;oxiran-2-ylmethyl 2-methylpropanoate has a molecular weight of 232.28 g/mol, XLogP of 1.31, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanoic acid;oxiran-2-ylmethyl 2-methylpropanoate is sourced from PubChem (CID 161434181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).