About bis(oxiran-2-ylmethyl) carbonate
bis(oxiran-2-ylmethyl) carbonate (PubChem CID 13170402) has the molecular formula C7H10O5
and a molecular weight of 174.15 g/mol. Its IUPAC name is bis(oxiran-2-ylmethyl) carbonate.
Molecular Properties
| Compound Name | bis(oxiran-2-ylmethyl) carbonate |
| PubChem CID | 13170402 |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | bis(oxiran-2-ylmethyl) carbonate |
| SMILES | O=C(OCC1CO1)OCC1CO1 |
| InChI | InChI=1S/C7H10O5/c8-7(11-3-5-1-9-5)12-4-6-2-10-6/h5-6H,1-4H2 |
| InChIKey | NTJYFWYFUKSSEM-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 60.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze bis(oxiran-2-ylmethyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(oxiran-2-ylmethyl) carbonate?
The IUPAC name of bis(oxiran-2-ylmethyl) carbonate (CID 13170402) is bis(oxiran-2-ylmethyl) carbonate.
What is the SMILES notation for bis(oxiran-2-ylmethyl) carbonate?
The canonical SMILES for bis(oxiran-2-ylmethyl) carbonate is O=C(OCC1CO1)OCC1CO1.
What is the InChIKey of bis(oxiran-2-ylmethyl) carbonate?
The InChIKey is NTJYFWYFUKSSEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O5/c8-7(11-3-5-1-9-5)12-4-6-2-10-6/h5-6H,1-4H2.
What are the key properties of bis(oxiran-2-ylmethyl) carbonate?
bis(oxiran-2-ylmethyl) carbonate has a molecular weight of 174.15 g/mol, XLogP of -0.06, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(oxiran-2-ylmethyl) carbonate is sourced from PubChem (CID 13170402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).