About oxiran-2-ylmethyl N-silylcarbamate
oxiran-2-ylmethyl N-silylcarbamate (PubChem CID 173486897) has the molecular formula C4H9NO3Si
and a molecular weight of 147.21 g/mol. Its IUPAC name is oxiran-2-ylmethyl N-silylcarbamate.
Molecular Properties
| Compound Name | oxiran-2-ylmethyl N-silylcarbamate |
| PubChem CID | 173486897 |
| Molecular Formula | C4H9NO3Si |
| Molecular Weight | 147.21 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | oxiran-2-ylmethyl N-silylcarbamate |
| SMILES | O=C(N[SiH3])OCC1CO1 |
| InChI | InChI=1S/C4H9NO3Si/c6-4(5-9)8-2-3-1-7-3/h3H,1-2H2,9H3,(H,5,6) |
| InChIKey | TUPURZDKHISQJZ-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.21 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxiran-2-ylmethyl N-silylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxiran-2-ylmethyl N-silylcarbamate?
The IUPAC name of oxiran-2-ylmethyl N-silylcarbamate (CID 173486897) is oxiran-2-ylmethyl N-silylcarbamate.
What is the SMILES notation for oxiran-2-ylmethyl N-silylcarbamate?
The canonical SMILES for oxiran-2-ylmethyl N-silylcarbamate is O=C(N[SiH3])OCC1CO1.
What is the InChIKey of oxiran-2-ylmethyl N-silylcarbamate?
The InChIKey is TUPURZDKHISQJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO3Si/c6-4(5-9)8-2-3-1-7-3/h3H,1-2H2,9H3,(H,5,6).
What are the key properties of oxiran-2-ylmethyl N-silylcarbamate?
oxiran-2-ylmethyl N-silylcarbamate has a molecular weight of 147.21 g/mol, XLogP of -1.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxiran-2-ylmethyl N-silylcarbamate is sourced from PubChem (CID 173486897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).