C16H28O6 — CID 59790513
1-O-(2-hydroxypropyl) 5-O-(oxiran-2-ylmethyl) 4-ethyl-2,2,4-trimethylpentanedioate (PubChem CID 59790513) has the molecular formula C16H28O6 and a molecular weight of 316.39 g/mol. Its IUPAC name is 1-O-(2-hydroxypropyl) 5-O-(oxiran-2-ylmethyl) 4-ethyl-2,2,4-trimethylpentanedioate.
| Compound Name | 1-O-(2-hydroxypropyl) 5-O-(oxiran-2-ylmethyl) 4-ethyl-2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 59790513 |
| Molecular Formula | C16H28O6 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-O-(2-hydroxypropyl) 5-O-(oxiran-2-ylmethyl) 4-ethyl-2,2,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCC(C)O)C(=O)OCC1CO1 |
| InChI | InChI=1S/C16H28O6/c1-6-16(5,14(19)22-9-12-8-20-12)10-15(3,4)13(18)21-7-11(2)17/h11-12,17H,6-10H2,1-5H3 |
| InChIKey | UIOBIQWUHAQMMI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|