C44H88N4O10 — CID 158342239
1-O-hexyl 5-O-[2-hydroxy-3-[2-(methylamino)ethylamino]propyl] 2-ethyl-2,4,4-trimethylpentanedioate;1-O-hexyl 5-O-(oxiran-2-ylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate;N'-methylethane-1,2-diamine (PubChem CID 158342239) has the molecular formula C44H88N4O10 and a molecular weight of 833.21 g/mol. Its IUPAC name is 1-O-hexyl 5-O-[2-hydroxy-3-[2-(methylamino)ethylamino]propyl] 2-ethyl-2,4,4-trimethylpentanedioate;1-O-hexyl 5-O-(oxiran-2-ylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate;N'-methylethane-1,2-diamine.
| Compound Name | 1-O-hexyl 5-O-[2-hydroxy-3-[2-(methylamino)ethylamino]propyl] 2-ethyl-2,4,4-trimethylpentanedioate;1-O-hexyl 5-O-(oxiran-2-ylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate;N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 158342239 |
| Molecular Formula | C44H88N4O10 |
| Molecular Weight | 833.21 g/mol |
| Exact Mass | 832.65 |
| IUPAC Name | 1-O-hexyl 5-O-[2-hydroxy-3-[2-(methylamino)ethylamino]propyl] 2-ethyl-2,4,4-trimethylpentanedioate;1-O-hexyl 5-O-(oxiran-2-ylmethyl) 2-ethyl-2,4,4-trimethylpentanedioate;N'-methylethane-1,2-diamine |
| SMILES | CCCCCCOC(=O)C(C)(CC)CC(C)(C)C(=O)OCC(O)CNCCNC.CCCCCCOC(=O)C(C)(CC)CC(C)(C)C(=O)OCC1CO1.CNCCN |
| InChI | InChI=1S/C22H44N2O5.C19H34O5.C3H10N2/c1-7-9-10-11-14-28-20(27)22(5,8-2)17-21(3,4)19(26)29-16-18(25)15-24-13-12-23-6;1-6-8-9-10-11-22-17(21)19(5,7-2)14-18(3,4)16(20)24-13-15-12-23-15;1-5-3-2-4/h18,23-25H,7-17H2,1-6H3;15H,6-14H2,1-5H3;5H,2-4H2,1H3 |
| InChIKey | GRHLIUGGGHSIGF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 200.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.21 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|