C36H65N3O8 — CID 21301790
oxiran-2-ylmethyl 4-[[(2-butyl-2-methylheptanoyl)amino]methylcarbamoyl]-8-carbamoyl-2,2,4,8-tetramethyl-6-(oxiran-2-ylmethoxymethyl)decanoate (PubChem CID 21301790) has the molecular formula C36H65N3O8 and a molecular weight of 667.93 g/mol. Its IUPAC name is oxiran-2-ylmethyl 4-[[(2-butyl-2-methylheptanoyl)amino]methylcarbamoyl]-8-carbamoyl-2,2,4,8-tetramethyl-6-(oxiran-2-ylmethoxymethyl)decanoate.
| Compound Name | oxiran-2-ylmethyl 4-[[(2-butyl-2-methylheptanoyl)amino]methylcarbamoyl]-8-carbamoyl-2,2,4,8-tetramethyl-6-(oxiran-2-ylmethoxymethyl)decanoate |
|---|---|
| PubChem CID | 21301790 |
| Molecular Formula | C36H65N3O8 |
| Molecular Weight | 667.93 g/mol |
| Exact Mass | 667.48 |
| IUPAC Name | oxiran-2-ylmethyl 4-[[(2-butyl-2-methylheptanoyl)amino]methylcarbamoyl]-8-carbamoyl-2,2,4,8-tetramethyl-6-(oxiran-2-ylmethoxymethyl)decanoate |
| SMILES | CCCCCC(C)(CCCC)C(=O)NCNC(=O)C(C)(CC(COCC1CO1)CC(C)(CC)C(N)=O)CC(C)(C)C(=O)OCC1CO1 |
| InChI | InChI=1S/C36H65N3O8/c1-9-12-14-16-35(7,15-13-10-2)30(41)38-25-39-31(42)36(8,24-33(4,5)32(43)47-23-28-22-46-28)18-26(19-44-20-27-21-45-27)17-34(6,11-3)29(37)40/h26-28H,9-25H2,1-8H3,(H2,37,40)(H,38,41)(H,39,42) |
| InChIKey | KAMNPGOUKJRGSB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 161.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.93 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|