C35H44O7 — CID 129174162
5-O-(anthracen-9-ylmethyl) 1-O-(oxiran-2-ylmethyl) 3-O-propyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 129174162) has the molecular formula C35H44O7 and a molecular weight of 576.73 g/mol. Its IUPAC name is 5-O-(anthracen-9-ylmethyl) 1-O-(oxiran-2-ylmethyl) 3-O-propyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 5-O-(anthracen-9-ylmethyl) 1-O-(oxiran-2-ylmethyl) 3-O-propyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 129174162 |
| Molecular Formula | C35H44O7 |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | 5-O-(anthracen-9-ylmethyl) 1-O-(oxiran-2-ylmethyl) 3-O-propyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCCOC(=O)C(C)(CC(C)(C)C(=O)OCC1CO1)CC(C)(CC)C(=O)OCc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C35H44O7/c1-7-17-39-32(38)35(6,22-33(3,4)30(36)41-20-26-19-40-26)23-34(5,8-2)31(37)42-21-29-27-15-11-9-13-24(27)18-25-14-10-12-16-28(25)29/h9-16,18,26H,7-8,17,19-23H2,1-6H3 |
| InChIKey | DKIZFHQFBHETMC-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|