C26H30O5 — CID 59974841
1-O-(anthracen-9-ylmethyl) 5-O-(hydroxymethyl) 4-ethyl-2,2,4-trimethylpentanedioate (PubChem CID 59974841) has the molecular formula C26H30O5 and a molecular weight of 422.52 g/mol. Its IUPAC name is 1-O-(anthracen-9-ylmethyl) 5-O-(hydroxymethyl) 4-ethyl-2,2,4-trimethylpentanedioate.
| Compound Name | 1-O-(anthracen-9-ylmethyl) 5-O-(hydroxymethyl) 4-ethyl-2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 59974841 |
| Molecular Formula | C26H30O5 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 1-O-(anthracen-9-ylmethyl) 5-O-(hydroxymethyl) 4-ethyl-2,2,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCc1c2ccccc2cc2ccccc12)C(=O)OCO |
| InChI | InChI=1S/C26H30O5/c1-5-26(4,24(29)31-17-27)16-25(2,3)23(28)30-15-22-20-12-8-6-10-18(20)14-19-11-7-9-13-21(19)22/h6-14,27H,5,15-17H2,1-4H3 |
| InChIKey | VACXGPMACLNWHN-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|