C29H34O5 — CID 54232964
1-O-anthracen-9-yl 5-O-(oxan-2-yl) 4-ethyl-2,2,4-trimethylpentanedioate (PubChem CID 54232964) has the molecular formula C29H34O5 and a molecular weight of 462.59 g/mol. Its IUPAC name is 1-O-anthracen-9-yl 5-O-(oxan-2-yl) 4-ethyl-2,2,4-trimethylpentanedioate.
| Compound Name | 1-O-anthracen-9-yl 5-O-(oxan-2-yl) 4-ethyl-2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 54232964 |
| Molecular Formula | C29H34O5 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 1-O-anthracen-9-yl 5-O-(oxan-2-yl) 4-ethyl-2,2,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)Oc1c2ccccc2cc2ccccc12)C(=O)OC1CCCCO1 |
| InChI | InChI=1S/C29H34O5/c1-5-29(4,27(31)33-24-16-10-11-17-32-24)19-28(2,3)26(30)34-25-22-14-8-6-12-20(22)18-21-13-7-9-15-23(21)25/h6-9,12-15,18,24H,5,10-11,16-17,19H2,1-4H3 |
| InChIKey | QKODRXPTEDNHIH-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|