C34H44O5 — CID 129175221
1-O-(anthracen-9-ylmethyl) 5-O-(oxiran-2-ylmethyl) 2-tert-butyl-4-(2,2-dimethylpropyl)-2,4-dimethylpentanedioate (PubChem CID 129175221) has the molecular formula C34H44O5 and a molecular weight of 532.72 g/mol. Its IUPAC name is 1-O-(anthracen-9-ylmethyl) 5-O-(oxiran-2-ylmethyl) 2-tert-butyl-4-(2,2-dimethylpropyl)-2,4-dimethylpentanedioate.
| Compound Name | 1-O-(anthracen-9-ylmethyl) 5-O-(oxiran-2-ylmethyl) 2-tert-butyl-4-(2,2-dimethylpropyl)-2,4-dimethylpentanedioate |
|---|---|
| PubChem CID | 129175221 |
| Molecular Formula | C34H44O5 |
| Molecular Weight | 532.72 g/mol |
| Exact Mass | 532.32 |
| IUPAC Name | 1-O-(anthracen-9-ylmethyl) 5-O-(oxiran-2-ylmethyl) 2-tert-butyl-4-(2,2-dimethylpropyl)-2,4-dimethylpentanedioate |
| SMILES | CC(C)(C)CC(C)(CC(C)(C(=O)OCc1c2ccccc2cc2ccccc12)C(C)(C)C)C(=O)OCC1CO1 |
| InChI | InChI=1S/C34H44O5/c1-31(2,3)21-33(7,29(35)38-19-25-18-37-25)22-34(8,32(4,5)6)30(36)39-20-28-26-15-11-9-13-23(26)17-24-14-10-12-16-27(24)28/h9-17,25H,18-22H2,1-8H3 |
| InChIKey | YHVYKOWHBPOZSM-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.72 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|