C33H39NO8 — CID 18335216
1-O-[(E)-anthracen-9-ylmethylideneamino] 3-O-(2-hydroxyethyl) 5-O-(oxiran-2-ylmethyl) 1,1,5-trimethylheptane-1,3,5-tricarboxylate (PubChem CID 18335216) has the molecular formula C33H39NO8 and a molecular weight of 577.67 g/mol. Its IUPAC name is 1-O-[(E)-anthracen-9-ylmethylideneamino] 3-O-(2-hydroxyethyl) 5-O-(oxiran-2-ylmethyl) 1,1,5-trimethylheptane-1,3,5-tricarboxylate.
| Compound Name | 1-O-[(E)-anthracen-9-ylmethylideneamino] 3-O-(2-hydroxyethyl) 5-O-(oxiran-2-ylmethyl) 1,1,5-trimethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 18335216 |
| Molecular Formula | C33H39NO8 |
| Molecular Weight | 577.67 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | 1-O-[(E)-anthracen-9-ylmethylideneamino] 3-O-(2-hydroxyethyl) 5-O-(oxiran-2-ylmethyl) 1,1,5-trimethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(C)(CC(CC(C)(C)C(=O)O/N=C/c1c2ccccc2cc2ccccc12)C(=O)OCCO)C(=O)OCC1CO1 |
| InChI | InChI=1S/C33H39NO8/c1-5-33(4,31(38)41-21-25-20-40-25)18-24(29(36)39-15-14-35)17-32(2,3)30(37)42-34-19-28-26-12-8-6-10-22(26)16-23-11-7-9-13-27(23)28/h6-13,16,19,24-25,35H,5,14-15,17-18,20-21H2,1-4H3/b34-19+ |
| InChIKey | KVOKMKWGSKLBEO-ALQBTCKLSA-N |
| XLogP | 5.19 |
| TPSA | 124.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.67 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|