C32H48O13S — CID 59113787
5-O-(2-hydroxyethyl) 3-O-methyl 7-O-[2-(4-methylphenyl)sulfonyloxyethyl] 1-O-(oxiran-2-ylmethyl) 1,1,5,7-tetramethylnonane-1,3,5,7-tetracarboxylate (PubChem CID 59113787) has the molecular formula C32H48O13S and a molecular weight of 672.79 g/mol. Its IUPAC name is 5-O-(2-hydroxyethyl) 3-O-methyl 7-O-[2-(4-methylphenyl)sulfonyloxyethyl] 1-O-(oxiran-2-ylmethyl) 1,1,5,7-tetramethylnonane-1,3,5,7-tetracarboxylate.
| Compound Name | 5-O-(2-hydroxyethyl) 3-O-methyl 7-O-[2-(4-methylphenyl)sulfonyloxyethyl] 1-O-(oxiran-2-ylmethyl) 1,1,5,7-tetramethylnonane-1,3,5,7-tetracarboxylate |
|---|---|
| PubChem CID | 59113787 |
| Molecular Formula | C32H48O13S |
| Molecular Weight | 672.79 g/mol |
| Exact Mass | 672.28 |
| IUPAC Name | 5-O-(2-hydroxyethyl) 3-O-methyl 7-O-[2-(4-methylphenyl)sulfonyloxyethyl] 1-O-(oxiran-2-ylmethyl) 1,1,5,7-tetramethylnonane-1,3,5,7-tetracarboxylate |
| SMILES | CCC(C)(CC(C)(CC(CC(C)(C)C(=O)OCC1CO1)C(=O)OC)C(=O)OCCO)C(=O)OCCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C32H48O13S/c1-8-31(5,28(36)42-15-16-45-46(38,39)25-11-9-22(2)10-12-25)21-32(6,29(37)41-14-13-33)18-23(26(34)40-7)17-30(3,4)27(35)44-20-24-19-43-24/h9-12,23-24,33H,8,13-21H2,1-7H3 |
| InChIKey | XBHFLBXWZCWTMO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 181.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.79 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|