C25H39NO9S — CID 22954486
1-O-(3-hydroxypropyl) 5-O-methyl 2,4,4-trimethyl-2-[2-[(4-methylphenyl)sulfonyloxymethylcarbamoyl]butyl]pentanedioate (PubChem CID 22954486) has the molecular formula C25H39NO9S and a molecular weight of 529.65 g/mol. Its IUPAC name is 1-O-(3-hydroxypropyl) 5-O-methyl 2,4,4-trimethyl-2-[2-[(4-methylphenyl)sulfonyloxymethylcarbamoyl]butyl]pentanedioate.
| Compound Name | 1-O-(3-hydroxypropyl) 5-O-methyl 2,4,4-trimethyl-2-[2-[(4-methylphenyl)sulfonyloxymethylcarbamoyl]butyl]pentanedioate |
|---|---|
| PubChem CID | 22954486 |
| Molecular Formula | C25H39NO9S |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | 1-O-(3-hydroxypropyl) 5-O-methyl 2,4,4-trimethyl-2-[2-[(4-methylphenyl)sulfonyloxymethylcarbamoyl]butyl]pentanedioate |
| SMILES | CCC(CC(C)(CC(C)(C)C(=O)OC)C(=O)OCCCO)C(=O)NCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H39NO9S/c1-7-19(21(28)26-17-35-36(31,32)20-11-9-18(2)10-12-20)15-25(5,23(30)34-14-8-13-27)16-24(3,4)22(29)33-6/h9-12,19,27H,7-8,13-17H2,1-6H3,(H,26,28) |
| InChIKey | XUVMMPSAQYKQEC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|