C18H29NO5S — CID 151749060
4-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl 4-methylbenzenesulfonate (PubChem CID 151749060) has the molecular formula C18H29NO5S and a molecular weight of 371.50 g/mol. Its IUPAC name is 4-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl 4-methylbenzenesulfonate.
| Compound Name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 151749060 |
| Molecular Formula | C18H29NO5S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl 4-methylbenzenesulfonate |
| SMILES | CCC(CCCOS(=O)(=O)c1ccc(C)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29NO5S/c1-6-15(19-17(20)24-18(3,4)5)8-7-13-23-25(21,22)16-11-9-14(2)10-12-16/h9-12,15H,6-8,13H2,1-5H3,(H,19,20) |
| InChIKey | RODDXQRJMNBLMM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|