C23H34INO8S — CID 88941686
ethyl (5S)-6-iodo-2-[3-(4-methylphenyl)sulfonyloxypropyl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoate (PubChem CID 88941686) has the molecular formula C23H34INO8S and a molecular weight of 611.50 g/mol. Its IUPAC name is ethyl (5S)-6-iodo-2-[3-(4-methylphenyl)sulfonyloxypropyl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoate.
| Compound Name | ethyl (5S)-6-iodo-2-[3-(4-methylphenyl)sulfonyloxypropyl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoate |
|---|---|
| PubChem CID | 88941686 |
| Molecular Formula | C23H34INO8S |
| Molecular Weight | 611.50 g/mol |
| Exact Mass | 611.10 |
| IUPAC Name | ethyl (5S)-6-iodo-2-[3-(4-methylphenyl)sulfonyloxypropyl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoate |
| SMILES | CCOC(=O)C(CCCOS(=O)(=O)c1ccc(C)cc1)CC[C@H](NC(=O)OC(C)(C)C)C(=O)I |
| InChI | InChI=1S/C23H34INO8S/c1-6-31-21(27)17(11-14-19(20(24)26)25-22(28)33-23(3,4)5)8-7-15-32-34(29,30)18-12-9-16(2)10-13-18/h9-10,12-13,17,19H,6-8,11,14-15H2,1-5H3,(H,25,28)/t17?,19-/m0/s1 |
| InChIKey | PKHLIDQWIWMYJF-NNBQYGFHSA-N |
| XLogP | 4.29 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|