C35H52N2O9S — CID 89120263
ditert-butyl (4S)-2-[[4-[3-(4-methylphenyl)sulfonyloxypropylamino]phenyl]methyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (PubChem CID 89120263) has the molecular formula C35H52N2O9S and a molecular weight of 676.87 g/mol. Its IUPAC name is ditert-butyl (4S)-2-[[4-[3-(4-methylphenyl)sulfonyloxypropylamino]phenyl]methyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate.
| Compound Name | ditert-butyl (4S)-2-[[4-[3-(4-methylphenyl)sulfonyloxypropylamino]phenyl]methyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
|---|---|
| PubChem CID | 89120263 |
| Molecular Formula | C35H52N2O9S |
| Molecular Weight | 676.87 g/mol |
| Exact Mass | 676.34 |
| IUPAC Name | ditert-butyl (4S)-2-[[4-[3-(4-methylphenyl)sulfonyloxypropylamino]phenyl]methyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCNc2ccc(CC(C[C@H](NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C35H52N2O9S/c1-24-12-18-28(19-13-24)47(41,42)43-21-11-20-36-27-16-14-25(15-17-27)22-26(30(38)44-33(2,3)4)23-29(31(39)45-34(5,6)7)37-32(40)46-35(8,9)10/h12-19,26,29,36H,11,20-23H2,1-10H3,(H,37,40)/t26?,29-/m0/s1 |
| InChIKey | GZQVHFCNRHZNIR-BTMGADRYSA-N |
| XLogP | 6.33 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.87 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|