About acetamidomethyl 4-methylbenzenesulfonate
acetamidomethyl 4-methylbenzenesulfonate (PubChem CID 142756617) has the molecular formula C10H13NO4S
and a molecular weight of 243.28 g/mol. Its IUPAC name is acetamidomethyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | acetamidomethyl 4-methylbenzenesulfonate |
| PubChem CID | 142756617 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | acetamidomethyl 4-methylbenzenesulfonate |
| SMILES | CC(=O)NCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C10H13NO4S/c1-8-3-5-10(6-4-8)16(13,14)15-7-11-9(2)12/h3-6H,7H2,1-2H3,(H,11,12) |
| InChIKey | QVWUSKCYOPXSNZ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze acetamidomethyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamidomethyl 4-methylbenzenesulfonate?
The IUPAC name of acetamidomethyl 4-methylbenzenesulfonate (CID 142756617) is acetamidomethyl 4-methylbenzenesulfonate.
What is the SMILES notation for acetamidomethyl 4-methylbenzenesulfonate?
The canonical SMILES for acetamidomethyl 4-methylbenzenesulfonate is CC(=O)NCOS(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of acetamidomethyl 4-methylbenzenesulfonate?
The InChIKey is QVWUSKCYOPXSNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4S/c1-8-3-5-10(6-4-8)16(13,14)15-7-11-9(2)12/h3-6H,7H2,1-2H3,(H,11,12).
What are the key properties of acetamidomethyl 4-methylbenzenesulfonate?
acetamidomethyl 4-methylbenzenesulfonate has a molecular weight of 243.28 g/mol, XLogP of 0.79, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetamidomethyl 4-methylbenzenesulfonate is sourced from PubChem (CID 142756617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).