C12H21NO4 — CID 21350463
oxiran-2-ylmethyl 4-carbamoyl-2,2-dimethylhexanoate (PubChem CID 21350463) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is oxiran-2-ylmethyl 4-carbamoyl-2,2-dimethylhexanoate.
| Compound Name | oxiran-2-ylmethyl 4-carbamoyl-2,2-dimethylhexanoate |
|---|---|
| PubChem CID | 21350463 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | oxiran-2-ylmethyl 4-carbamoyl-2,2-dimethylhexanoate |
| SMILES | CCC(CC(C)(C)C(=O)OCC1CO1)C(N)=O |
| InChI | InChI=1S/C12H21NO4/c1-4-8(10(13)14)5-12(2,3)11(15)17-7-9-6-16-9/h8-9H,4-7H2,1-3H3,(H2,13,14) |
| InChIKey | UYKQXBLFHXDDQP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|