C55H61NO11 — CID 59921372
8-O-(anthracen-9-ylmethyl) 1-O-[2-(anthracen-9-ylmethylideneamino)oxyethyl] 3-O-(2-hydroxyethyl) 6-O-[2-(oxiran-2-yl)ethyl] 1,6,8-trimethyldecane-1,3,6,8-tetracarboxylate (PubChem CID 59921372) has the molecular formula C55H61NO11 and a molecular weight of 912.09 g/mol. Its IUPAC name is 8-O-(anthracen-9-ylmethyl) 1-O-[2-(anthracen-9-ylmethylideneamino)oxyethyl] 3-O-(2-hydroxyethyl) 6-O-[2-(oxiran-2-yl)ethyl] 1,6,8-trimethyldecane-1,3,6,8-tetracarboxylate.
| Compound Name | 8-O-(anthracen-9-ylmethyl) 1-O-[2-(anthracen-9-ylmethylideneamino)oxyethyl] 3-O-(2-hydroxyethyl) 6-O-[2-(oxiran-2-yl)ethyl] 1,6,8-trimethyldecane-1,3,6,8-tetracarboxylate |
|---|---|
| PubChem CID | 59921372 |
| Molecular Formula | C55H61NO11 |
| Molecular Weight | 912.09 g/mol |
| Exact Mass | 911.42 |
| IUPAC Name | 8-O-(anthracen-9-ylmethyl) 1-O-[2-(anthracen-9-ylmethylideneamino)oxyethyl] 3-O-(2-hydroxyethyl) 6-O-[2-(oxiran-2-yl)ethyl] 1,6,8-trimethyldecane-1,3,6,8-tetracarboxylate |
| SMILES | CCC(C)(CC(C)(CCC(CC(C)C(=O)OCCON=Cc1c2ccccc2cc2ccccc12)C(=O)OCCO)C(=O)OCCC1CO1)C(=O)OCc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C55H61NO11/c1-5-54(3,52(60)66-35-49-46-20-12-8-16-40(46)32-41-17-9-13-21-47(41)49)36-55(4,53(61)64-26-23-43-34-65-43)24-22-42(51(59)62-27-25-57)30-37(2)50(58)63-28-29-67-56-33-48-44-18-10-6-14-38(44)31-39-15-7-11-19-45(39)48/h6-21,31-33,37,42-43,57H,5,22-30,34-36H2,1-4H3 |
| InChIKey | SXYRQLIAEIYABU-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 159.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.09 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|