C12H20Si — CID 173451973
(3,3-dimethyl-1-phenylbutyl)silane (PubChem CID 173451973) has the molecular formula C12H20Si and a molecular weight of 192.38 g/mol. Its IUPAC name is (3,3-dimethyl-1-phenylbutyl)silane.
| Compound Name | (3,3-dimethyl-1-phenylbutyl)silane |
|---|---|
| PubChem CID | 173451973 |
| Molecular Formula | C12H20Si |
| Molecular Weight | 192.38 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | (3,3-dimethyl-1-phenylbutyl)silane |
| SMILES | CC(C)(C)CC([SiH3])c1ccccc1 |
| InChI | InChI=1S/C12H20Si/c1-12(2,3)9-11(13)10-7-5-4-6-8-10/h4-8,11H,9H2,1-3,13H3 |
| InChIKey | UHZYCZNOSONXCX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|