About 1-phenylbutylsilane
1-phenylbutylsilane (PubChem CID 173332415) has the molecular formula C10H16Si
and a molecular weight of 164.32 g/mol. Its IUPAC name is 1-phenylbutylsilane.
Molecular Properties
| Compound Name | 1-phenylbutylsilane |
| PubChem CID | 173332415 |
| Molecular Formula | C10H16Si |
| Molecular Weight | 164.32 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | 1-phenylbutylsilane |
| SMILES | CCCC([SiH3])c1ccccc1 |
| InChI | InChI=1S/C10H16Si/c1-2-6-10(11)9-7-4-3-5-8-9/h3-5,7-8,10H,2,6H2,1,11H3 |
| InChIKey | VAFAICZIMXQVMM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylbutylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylbutylsilane?
The IUPAC name of 1-phenylbutylsilane (CID 173332415) is 1-phenylbutylsilane.
What is the SMILES notation for 1-phenylbutylsilane?
The canonical SMILES for 1-phenylbutylsilane is CCCC([SiH3])c1ccccc1.
What is the InChIKey of 1-phenylbutylsilane?
The InChIKey is VAFAICZIMXQVMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16Si/c1-2-6-10(11)9-7-4-3-5-8-9/h3-5,7-8,10H,2,6H2,1,11H3.
What are the key properties of 1-phenylbutylsilane?
1-phenylbutylsilane has a molecular weight of 164.32 g/mol, XLogP of 1.89, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylbutylsilane is sourced from PubChem (CID 173332415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).