About potassium 1-phenylbutan-1-olate
potassium 1-phenylbutan-1-olate (PubChem CID 70503284) has the molecular formula C10H13KO
and a molecular weight of 188.31 g/mol. Its IUPAC name is potassium 1-phenylbutan-1-olate.
Molecular Properties
| Compound Name | potassium 1-phenylbutan-1-olate |
| PubChem CID | 70503284 |
| Molecular Formula | C10H13KO |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | potassium 1-phenylbutan-1-olate |
| SMILES | CCCC([O-])c1ccccc1.[K+] |
| InChI | InChI=1S/C10H13O.K/c1-2-6-10(11)9-7-4-3-5-8-9;/h3-5,7-8,10H,2,6H2,1H3;/q-1;+1 |
| InChIKey | HWMCNVBDGREWIN-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze potassium 1-phenylbutan-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 1-phenylbutan-1-olate?
The IUPAC name of potassium 1-phenylbutan-1-olate (CID 70503284) is potassium 1-phenylbutan-1-olate.
What is the SMILES notation for potassium 1-phenylbutan-1-olate?
The canonical SMILES for potassium 1-phenylbutan-1-olate is CCCC([O-])c1ccccc1.[K+].
What is the InChIKey of potassium 1-phenylbutan-1-olate?
The InChIKey is HWMCNVBDGREWIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13O.K/c1-2-6-10(11)9-7-4-3-5-8-9;/h3-5,7-8,10H,2,6H2,1H3;/q-1;+1.
What are the key properties of potassium 1-phenylbutan-1-olate?
potassium 1-phenylbutan-1-olate has a molecular weight of 188.31 g/mol, XLogP of -1.11, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 1-phenylbutan-1-olate is sourced from PubChem (CID 70503284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).