About sodium 1-phenylbutan-1-olate
sodium 1-phenylbutan-1-olate (PubChem CID 70503341) has the molecular formula C10H13NaO
and a molecular weight of 172.20 g/mol. Its IUPAC name is sodium 1-phenylbutan-1-olate.
Molecular Properties
| Compound Name | sodium 1-phenylbutan-1-olate |
| PubChem CID | 70503341 |
| Molecular Formula | C10H13NaO |
| Molecular Weight | 172.20 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | sodium 1-phenylbutan-1-olate |
| SMILES | CCCC([O-])c1ccccc1.[Na+] |
| InChI | InChI=1S/C10H13O.Na/c1-2-6-10(11)9-7-4-3-5-8-9;/h3-5,7-8,10H,2,6H2,1H3;/q-1;+1 |
| InChIKey | BWDUPYAYPOMIBH-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.20 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze sodium 1-phenylbutan-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 1-phenylbutan-1-olate?
The IUPAC name of sodium 1-phenylbutan-1-olate (CID 70503341) is sodium 1-phenylbutan-1-olate.
What is the SMILES notation for sodium 1-phenylbutan-1-olate?
The canonical SMILES for sodium 1-phenylbutan-1-olate is CCCC([O-])c1ccccc1.[Na+].
What is the InChIKey of sodium 1-phenylbutan-1-olate?
The InChIKey is BWDUPYAYPOMIBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13O.Na/c1-2-6-10(11)9-7-4-3-5-8-9;/h3-5,7-8,10H,2,6H2,1H3;/q-1;+1.
What are the key properties of sodium 1-phenylbutan-1-olate?
sodium 1-phenylbutan-1-olate has a molecular weight of 172.20 g/mol, XLogP of -1.11, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1-phenylbutan-1-olate is sourced from PubChem (CID 70503341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).