sodium diphenylmethanolate

C13H11NaO — CID 22420719

IUPACsodium diphenylmethanolate
SMILES[Na+].[O-]C(c1ccccc1)c1ccccc1
InChIInChI=1S/C13H11O.Na/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10,13H;/q-1;+1
InChIKeyVVZNBNMGXZOZPB-UHFFFAOYSA-N
MW206.22 g/mol
LogP-0.86
Rot. Bonds2

About sodium diphenylmethanolate

sodium diphenylmethanolate (PubChem CID 22420719) has the molecular formula C13H11NaO and a molecular weight of 206.22 g/mol. Its IUPAC name is sodium diphenylmethanolate.

Molecular Properties

Compound Namesodium diphenylmethanolate
PubChem CID22420719
Molecular FormulaC13H11NaO
Molecular Weight206.22 g/mol
Exact Mass206.07
IUPAC Namesodium diphenylmethanolate
SMILES[Na+].[O-]C(c1ccccc1)c1ccccc1
InChIInChI=1S/C13H11O.Na/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10,13H;/q-1;+1
InChIKeyVVZNBNMGXZOZPB-UHFFFAOYSA-N
XLogP-0.86
TPSA23.06 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.22
LogP ≤ 5-0.86
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze sodium diphenylmethanolate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium diphenylmethanolate?
The IUPAC name of sodium diphenylmethanolate (CID 22420719) is sodium diphenylmethanolate.
What is the SMILES notation for sodium diphenylmethanolate?
The canonical SMILES for sodium diphenylmethanolate is [Na+].[O-]C(c1ccccc1)c1ccccc1.
What is the InChIKey of sodium diphenylmethanolate?
The InChIKey is VVZNBNMGXZOZPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11O.Na/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10,13H;/q-1;+1.
What are the key properties of sodium diphenylmethanolate?
sodium diphenylmethanolate has a molecular weight of 206.22 g/mol, XLogP of -0.86, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium diphenylmethanolate is sourced from PubChem (CID 22420719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).