About sodium diphenylmethanolate
sodium diphenylmethanolate (PubChem CID 22420719) has the molecular formula C13H11NaO
and a molecular weight of 206.22 g/mol. Its IUPAC name is sodium diphenylmethanolate.
Molecular Properties
| Compound Name | sodium diphenylmethanolate |
| PubChem CID | 22420719 |
| Molecular Formula | C13H11NaO |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | sodium diphenylmethanolate |
| SMILES | [Na+].[O-]C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H11O.Na/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10,13H;/q-1;+1 |
| InChIKey | VVZNBNMGXZOZPB-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze sodium diphenylmethanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium diphenylmethanolate?
The IUPAC name of sodium diphenylmethanolate (CID 22420719) is sodium diphenylmethanolate.
What is the SMILES notation for sodium diphenylmethanolate?
The canonical SMILES for sodium diphenylmethanolate is [Na+].[O-]C(c1ccccc1)c1ccccc1.
What is the InChIKey of sodium diphenylmethanolate?
The InChIKey is VVZNBNMGXZOZPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11O.Na/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10,13H;/q-1;+1.
What are the key properties of sodium diphenylmethanolate?
sodium diphenylmethanolate has a molecular weight of 206.22 g/mol, XLogP of -0.86, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium diphenylmethanolate is sourced from PubChem (CID 22420719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).