About diphenylmethanolate
diphenylmethanolate (PubChem CID 57466266) has the molecular formula C13H11O-
and a molecular weight of 183.23 g/mol. Its IUPAC name is diphenylmethanolate.
Molecular Properties
| Compound Name | diphenylmethanolate |
| PubChem CID | 57466266 |
| Molecular Formula | C13H11O- |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | diphenylmethanolate |
| SMILES | [O-]C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H11O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H/q-1 |
| InChIKey | CVSMARLYJHTNIY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze diphenylmethanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanolate?
The IUPAC name of diphenylmethanolate (CID 57466266) is diphenylmethanolate.
What is the SMILES notation for diphenylmethanolate?
The canonical SMILES for diphenylmethanolate is [O-]C(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanolate?
The InChIKey is CVSMARLYJHTNIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H/q-1.
What are the key properties of diphenylmethanolate?
diphenylmethanolate has a molecular weight of 183.23 g/mol, XLogP of 2.14, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanolate is sourced from PubChem (CID 57466266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).