About butane;1-phenylethane-1,2-diolate;tin(2+)
butane;1-phenylethane-1,2-diolate;tin(2+) (PubChem CID 171375655) has the molecular formula C16H28O2Sn
and a molecular weight of 371.11 g/mol. Its IUPAC name is butane;1-phenylethane-1,2-diolate;tin(2+).
Molecular Properties
| Compound Name | butane;1-phenylethane-1,2-diolate;tin(2+) |
| PubChem CID | 171375655 |
| Molecular Formula | C16H28O2Sn |
| Molecular Weight | 371.11 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | butane;1-phenylethane-1,2-diolate;tin(2+) |
| SMILES | CCCC.CCCC.[O-]CC([O-])c1ccccc1.[Sn+2] |
| InChI | InChI=1S/C8H8O2.2C4H10.Sn/c9-6-8(10)7-4-2-1-3-5-7;2*1-3-4-2;/h1-5,8H,6H2;2*3-4H2,1-2H3;/q-2;;;+2 |
| InChIKey | XYZXGPFONBPUJC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.11 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butane;1-phenylethane-1,2-diolate;tin(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;1-phenylethane-1,2-diolate;tin(2+)?
The IUPAC name of butane;1-phenylethane-1,2-diolate;tin(2+) (CID 171375655) is butane;1-phenylethane-1,2-diolate;tin(2+).
What is the SMILES notation for butane;1-phenylethane-1,2-diolate;tin(2+)?
The canonical SMILES for butane;1-phenylethane-1,2-diolate;tin(2+) is CCCC.CCCC.[O-]CC([O-])c1ccccc1.[Sn+2].
What is the InChIKey of butane;1-phenylethane-1,2-diolate;tin(2+)?
The InChIKey is XYZXGPFONBPUJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.2C4H10.Sn/c9-6-8(10)7-4-2-1-3-5-7;2*1-3-4-2;/h1-5,8H,6H2;2*3-4H2,1-2H3;/q-2;;;+2.
What are the key properties of butane;1-phenylethane-1,2-diolate;tin(2+)?
butane;1-phenylethane-1,2-diolate;tin(2+) has a molecular weight of 371.11 g/mol, XLogP of 2.68, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;1-phenylethane-1,2-diolate;tin(2+) is sourced from PubChem (CID 171375655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).