About CID 140568629
CID 140568629 (PubChem CID 140568629) has the molecular formula C14H13Al
and a molecular weight of 208.24 g/mol.
Molecular Properties
| Compound Name | CID 140568629 |
| PubChem CID | 140568629 |
| Molecular Formula | C14H13Al |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | — |
| SMILES | [Al]CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H13.Al/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;/h2-12H,1H2; |
| InChIKey | SQDRYZBKLWVGLQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 140568629 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140568629?
The IUPAC name of CID 140568629 (CID 140568629) is not available.
What is the SMILES notation for CID 140568629?
The canonical SMILES for CID 140568629 is [Al]CC(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 140568629?
The InChIKey is SQDRYZBKLWVGLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13.Al/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;/h2-12H,1H2;.
What are the key properties of CID 140568629?
CID 140568629 has a molecular weight of 208.24 g/mol, XLogP of 3.41, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140568629 is sourced from PubChem (CID 140568629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).