C28H26OSn2 — CID 70496172
2,2-diphenylethyl-(2,2-diphenylethyl-λ2-stannanyl)oxytin (PubChem CID 70496172) has the molecular formula C28H26OSn2 and a molecular weight of 615.94 g/mol. Its IUPAC name is 2,2-diphenylethyl-(2,2-diphenylethyl-λ2-stannanyl)oxytin.
| Compound Name | 2,2-diphenylethyl-(2,2-diphenylethyl-λ2-stannanyl)oxytin |
|---|---|
| PubChem CID | 70496172 |
| Molecular Formula | C28H26OSn2 |
| Molecular Weight | 615.94 g/mol |
| Exact Mass | 618.00 |
| IUPAC Name | 2,2-diphenylethyl-(2,2-diphenylethyl-λ2-stannanyl)oxytin |
| SMILES | c1ccc(C(C[Sn]O[Sn]CC(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C14H13.O.2Sn/c2*1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;;;/h2*2-12H,1H2;;; |
| InChIKey | PSJFNGVVDOMVBD-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.94 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|