C16H17ClSn — CID 70495982
chloro(4,4-diphenylbutyl)tin (PubChem CID 70495982) has the molecular formula C16H17ClSn and a molecular weight of 363.48 g/mol. Its IUPAC name is chloro(4,4-diphenylbutyl)tin.
| Compound Name | chloro(4,4-diphenylbutyl)tin |
|---|---|
| PubChem CID | 70495982 |
| Molecular Formula | C16H17ClSn |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | chloro(4,4-diphenylbutyl)tin |
| SMILES | Cl[Sn]CCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17.ClH.Sn/c1-2-9-16(14-10-5-3-6-11-14)15-12-7-4-8-13-15;;/h3-8,10-13,16H,1-2,9H2;1H;/q;;+1/p-1 |
| InChIKey | XIAPWBANXIFUJU-UHFFFAOYSA-M |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|