About trichloro(3,3-diphenylpropyl)silane
trichloro(3,3-diphenylpropyl)silane (PubChem CID 19360814) has the molecular formula C15H15Cl3Si
and a molecular weight of 329.73 g/mol. Its IUPAC name is trichloro(3,3-diphenylpropyl)silane.
Molecular Properties
| Compound Name | trichloro(3,3-diphenylpropyl)silane |
| PubChem CID | 19360814 |
| Molecular Formula | C15H15Cl3Si |
| Molecular Weight | 329.73 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | trichloro(3,3-diphenylpropyl)silane |
| SMILES | Cl[Si](Cl)(Cl)CCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H15Cl3Si/c16-19(17,18)12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15H,11-12H2 |
| InChIKey | FOJUKCRRUWDWGX-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.73 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze trichloro(3,3-diphenylpropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichloro(3,3-diphenylpropyl)silane?
The IUPAC name of trichloro(3,3-diphenylpropyl)silane (CID 19360814) is trichloro(3,3-diphenylpropyl)silane.
What is the SMILES notation for trichloro(3,3-diphenylpropyl)silane?
The canonical SMILES for trichloro(3,3-diphenylpropyl)silane is Cl[Si](Cl)(Cl)CCC(c1ccccc1)c1ccccc1.
What is the InChIKey of trichloro(3,3-diphenylpropyl)silane?
The InChIKey is FOJUKCRRUWDWGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15Cl3Si/c16-19(17,18)12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15H,11-12H2.
What are the key properties of trichloro(3,3-diphenylpropyl)silane?
trichloro(3,3-diphenylpropyl)silane has a molecular weight of 329.73 g/mol, XLogP of 5.86, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trichloro(3,3-diphenylpropyl)silane is sourced from PubChem (CID 19360814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).