C14H11Cl3 — CID 18085
(2,2,2-trichloro-1-phenylethyl)benzene (PubChem CID 18085) has the molecular formula C14H11Cl3 and a molecular weight of 285.60 g/mol. Its IUPAC name is (2,2,2-trichloro-1-phenylethyl)benzene.
| Compound Name | (2,2,2-trichloro-1-phenylethyl)benzene |
|---|---|
| PubChem CID | 18085 |
| Molecular Formula | C14H11Cl3 |
| Molecular Weight | 285.60 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | (2,2,2-trichloro-1-phenylethyl)benzene |
| SMILES | ClC(Cl)(Cl)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H11Cl3/c15-14(16,17)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H |
| InChIKey | ZADGQTHIZZOKGE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.60 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|