C16H17O2S- — CID 67315060
4,4-diphenylbutane-1-sulfinate (PubChem CID 67315060) has the molecular formula C16H17O2S- and a molecular weight of 273.38 g/mol. Its IUPAC name is 4,4-diphenylbutane-1-sulfinate.
| Compound Name | 4,4-diphenylbutane-1-sulfinate |
|---|---|
| PubChem CID | 67315060 |
| Molecular Formula | C16H17O2S- |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 4,4-diphenylbutane-1-sulfinate |
| SMILES | O=S([O-])CCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H18O2S/c17-19(18)13-7-12-16(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,16H,7,12-13H2,(H,17,18)/p-1 |
| InChIKey | NRUIBUIWWPBXIW-UHFFFAOYSA-M |
| XLogP | 3.48 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|