C20H26OP+ — CID 173421020
8,8-diphenyloctyl(oxo)phosphanium (PubChem CID 173421020) has the molecular formula C20H26OP+ and a molecular weight of 313.40 g/mol. Its IUPAC name is 8,8-diphenyloctyl(oxo)phosphanium.
| Compound Name | 8,8-diphenyloctyl(oxo)phosphanium |
|---|---|
| PubChem CID | 173421020 |
| Molecular Formula | C20H26OP+ |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 8,8-diphenyloctyl(oxo)phosphanium |
| SMILES | O=[PH+]CCCCCCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25OP/c21-22-17-11-3-1-2-10-16-20(18-12-6-4-7-13-18)19-14-8-5-9-15-19/h4-9,12-15,20H,1-3,10-11,16-17H2/p+1 |
| InChIKey | LRZCNVXFJRAGDQ-UHFFFAOYSA-O |
| XLogP | 6.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|