C19H25N — CID 21426298
7,7-diphenylheptan-3-amine (PubChem CID 21426298) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is 7,7-diphenylheptan-3-amine.
| Compound Name | 7,7-diphenylheptan-3-amine |
|---|---|
| PubChem CID | 21426298 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 7,7-diphenylheptan-3-amine |
| SMILES | CCC(N)CCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H25N/c1-2-18(20)14-9-15-19(16-10-5-3-6-11-16)17-12-7-4-8-13-17/h3-8,10-13,18-19H,2,9,14-15,20H2,1H3 |
| InChIKey | AZVOKLJKMLLEJM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |