C28H28Cl2N2-2 — CID 51371244
N,N'-dibenzhydrylethane-1,2-diamine dichloride (PubChem CID 51371244) has the molecular formula C28H28Cl2N2-2 and a molecular weight of 463.45 g/mol. Its IUPAC name is N,N'-dibenzhydrylethane-1,2-diamine dichloride.
| Compound Name | N,N'-dibenzhydrylethane-1,2-diamine dichloride |
|---|---|
| PubChem CID | 51371244 |
| Molecular Formula | C28H28Cl2N2-2 |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | N,N'-dibenzhydrylethane-1,2-diamine dichloride |
| SMILES | [Cl-].[Cl-].c1ccc(C(NCCNC(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H28N2.2ClH/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)29-21-22-30-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;;/h1-20,27-30H,21-22H2;2*1H/p-2 |
| InChIKey | YRQCDCNQANSUPB-UHFFFAOYSA-L |
| XLogP | -0.25 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|