About N-benzhydrylethanamine;ethane
N-benzhydrylethanamine;ethane (PubChem CID 142974710) has the molecular formula C17H23N
and a molecular weight of 241.38 g/mol. Its IUPAC name is N-benzhydrylethanamine;ethane.
Molecular Properties
| Compound Name | N-benzhydrylethanamine;ethane |
| PubChem CID | 142974710 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | N-benzhydrylethanamine;ethane |
| SMILES | CC.CCNC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H17N.C2H6/c1-2-16-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;1-2/h3-12,15-16H,2H2,1H3;1-2H3 |
| InChIKey | GPYMSLFLDYJXHX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-benzhydrylethanamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzhydrylethanamine;ethane?
The IUPAC name of N-benzhydrylethanamine;ethane (CID 142974710) is N-benzhydrylethanamine;ethane.
What is the SMILES notation for N-benzhydrylethanamine;ethane?
The canonical SMILES for N-benzhydrylethanamine;ethane is CC.CCNC(c1ccccc1)c1ccccc1.
What is the InChIKey of N-benzhydrylethanamine;ethane?
The InChIKey is GPYMSLFLDYJXHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N.C2H6/c1-2-16-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;1-2/h3-12,15-16H,2H2,1H3;1-2H3.
What are the key properties of N-benzhydrylethanamine;ethane?
N-benzhydrylethanamine;ethane has a molecular weight of 241.38 g/mol, XLogP of 4.41, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzhydrylethanamine;ethane is sourced from PubChem (CID 142974710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).