C15H18ClN — CID 74764483
3,3-diphenylpropan-1-amine;hydron;chloride (PubChem CID 74764483) has the molecular formula C15H18ClN and a molecular weight of 247.77 g/mol. Its IUPAC name is 3,3-diphenylpropan-1-amine;hydron;chloride.
| Compound Name | 3,3-diphenylpropan-1-amine;hydron;chloride |
|---|---|
| PubChem CID | 74764483 |
| Molecular Formula | C15H18ClN |
| Molecular Weight | 247.77 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 3,3-diphenylpropan-1-amine;hydron;chloride |
| SMILES | NCCC(c1ccccc1)c1ccccc1.[Cl-].[H+] |
| InChI | InChI=1S/C15H17N.ClH/c16-12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14;/h1-10,15H,11-12,16H2;1H |
| InChIKey | AHHLKJBLNXAJID-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.77 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |