C10H13F2N — CID 115016853
4,4-difluoro-3-phenylbutan-1-amine (PubChem CID 115016853) has the molecular formula C10H13F2N and a molecular weight of 185.22 g/mol. Its IUPAC name is 4,4-difluoro-3-phenylbutan-1-amine.
| Compound Name | 4,4-difluoro-3-phenylbutan-1-amine |
|---|---|
| PubChem CID | 115016853 |
| Molecular Formula | C10H13F2N |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 4,4-difluoro-3-phenylbutan-1-amine |
| SMILES | NCCC(c1ccccc1)C(F)F |
| InChI | InChI=1S/C10H13F2N/c11-10(12)9(6-7-13)8-4-2-1-3-5-8/h1-5,9-10H,6-7,13H2 |
| InChIKey | XVXZDZBRCLTLCZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |