C21H21N — CID 11781172
2,3,3-triphenylpropan-1-amine (PubChem CID 11781172) has the molecular formula C21H21N and a molecular weight of 287.41 g/mol. Its IUPAC name is 2,3,3-triphenylpropan-1-amine.
| Compound Name | 2,3,3-triphenylpropan-1-amine |
|---|---|
| PubChem CID | 11781172 |
| Molecular Formula | C21H21N |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 2,3,3-triphenylpropan-1-amine |
| SMILES | NCC(c1ccccc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H21N/c22-16-20(17-10-4-1-5-11-17)21(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,20-21H,16,22H2 |
| InChIKey | XKGCCPYCHHNFAB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |