C15H20Cl2N2 — CID 141351446
3,3-diphenylpropane-1,2-diamine;dihydrochloride (PubChem CID 141351446) has the molecular formula C15H20Cl2N2 and a molecular weight of 299.25 g/mol. Its IUPAC name is 3,3-diphenylpropane-1,2-diamine;dihydrochloride.
| Compound Name | 3,3-diphenylpropane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 141351446 |
| Molecular Formula | C15H20Cl2N2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 3,3-diphenylpropane-1,2-diamine;dihydrochloride |
| SMILES | Cl.Cl.NCC(N)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H18N2.2ClH/c16-11-14(17)15(12-7-3-1-4-8-12)13-9-5-2-6-10-13;;/h1-10,14-15H,11,16-17H2;2*1H |
| InChIKey | LVGJCCPDNQJHFE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |